| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:19 UTC |
|---|
| Update Date | 2025-03-21 18:02:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00036932 |
|---|
| Frequency | 95.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H11NO4 |
|---|
| Molecular Mass | 209.0688 |
|---|
| SMILES | COC(=O)c1cc(NC(C)=O)ccc1O |
|---|
| InChI Key | JOILLVHUXHWRQB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | acylaminobenzoic acid and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetamidesacetanilidesbenzoyl derivativescarbonyl compoundshydrocarbon derivativesmethyl estersmonocarboxylic acids and derivativesn-acetylarylaminesorganic oxidesorganopnictogen compoundssalicylic acid and derivativessecondary carboxylic acid amidesvinylogous acidso-hydroxybenzoic acid esters |
|---|
| Substituents | carbonyl groupn-acetylarylaminebenzoyl1-hydroxy-2-unsubstituted benzenoidn-arylamidebenzoate estercarboxylic acid derivativeorganic oxidemethyl esterorganonitrogen compoundorganopnictogen compoundacetamideacylaminobenzoic acid or derivativesacetanilidecarboxamide grouparomatic homomonocyclic compoundanilidesecondary carboxylic acid amidevinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundsalicylic acid or derivativeso-hydroxybenzoic acid estercarboxylic acid esterphenolhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
