| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:22 UTC |
|---|
| Update Date | 2025-03-21 18:02:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00037062 |
|---|
| Frequency | 114.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12N4O3 |
|---|
| Molecular Mass | 224.0909 |
|---|
| SMILES | CC(O)C(O)C1CN=c2[nH]cnc(=O)c2=N1 |
|---|
| InChI Key | RIROFYPVIGXDMZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrimidonessecondary alcoholsvinylogous amides |
|---|
| Substituents | alcoholvinylogous amideazacycleheteroaromatic compoundpyrimidonepteridinepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundimidolactamorganooxygen compound1,2-diol |
|---|
