Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-20 23:49:23 UTC |
---|
Update Date | 2025-03-21 18:02:14 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00037074 |
---|
Frequency | 95.2 |
---|
Structure | |
---|
Chemical Formula | C9H9NO6S |
---|
Molecular Mass | 259.0151 |
---|
SMILES | CC(=O)Nc1ccc(C(=O)OS(=O)(=O)O)cc1 |
---|
InChI Key | VAEYYTJOWDSHIX-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | benzoic acids and derivatives |
---|
Direct Parent | acylaminobenzoic acid and derivatives |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | acetamidesacetanilidesbenzoyl derivativescarbonyl compoundshydrocarbon derivativesmonocarboxylic acids and derivativesn-acetylarylaminesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amidessulfuric acid monoesters |
---|
Substituents | sulfuric acid monoestercarbonyl groupn-acetylarylaminebenzoyln-arylamidecarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundacetamideacylaminobenzoic acid or derivativesorganic sulfuric acid or derivativesacetanilidecarboxamide grouparomatic homomonocyclic compoundanilidesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundsulfuric acid esterorganooxygen compound |
---|