| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:25 UTC |
|---|
| Update Date | 2025-03-21 18:02:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00037160 |
|---|
| Frequency | 94.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H20O4 |
|---|
| Molecular Mass | 312.1362 |
|---|
| SMILES | O=C(CCc1ccc(O)cc1)CC(=O)CCc1cccc(O)c1 |
|---|
| InChI Key | FUEXLQMYNGKTKM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | diarylheptanoids |
|---|
| Subclass | linear diarylheptanoids |
|---|
| Direct Parent | linear diarylheptanoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativeshydrocarbon derivativesketonesorganic oxides |
|---|
| Substituents | monocyclic benzene moietycarbonyl group1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidketonearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundlinear 1,7-diphenylheptane skeletonphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|