| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:26 UTC |
|---|
| Update Date | 2025-03-21 18:02:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00037216 |
|---|
| Frequency | 94.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H16O5 |
|---|
| Molecular Mass | 324.0998 |
|---|
| SMILES | O=C(C=Cc1ccc(O)cc1)CC(=O)C=Cc1ccc(O)c(O)c1 |
|---|
| InChI Key | YZCBFQDXCIWDOS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | diarylheptanoids |
|---|
| Subclass | linear diarylheptanoids |
|---|
| Direct Parent | linear diarylheptanoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacryloyl compoundsbenzene and substituted derivativesenoneshydrocarbon derivativeshydroxycinnamic acidsketonesorganic oxides |
|---|
| Substituents | monocyclic benzene moietycarbonyl group1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidalpha,beta-unsaturated ketonehydroxycinnamic acid or derivativeshydroxycinnamic acidketonearomatic homomonocyclic compoundcinnamic acid or derivativesorganic oxideorganic oxygen compoundlinear 1,7-diphenylheptane skeletonphenolhydrocarbon derivativebenzenoidacryloyl-grouporganooxygen compoundenone |
|---|