| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:27 UTC |
|---|
| Update Date | 2025-03-21 18:02:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00037259 |
|---|
| Frequency | 94.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H18O3 |
|---|
| Molecular Mass | 282.1256 |
|---|
| SMILES | CC(C)COC(=O)c1ccccc1C(=O)c1ccccc1 |
|---|
| InChI Key | PVZWOKVZXHOQAJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl ketonesaryl-phenylketonesbenzoic acid estersbenzoyl derivativescarboxylic acid estersdiphenylmethaneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compounds |
|---|
| Substituents | diphenylmethanearyl-phenylketonebenzoylbenzoic acid or derivativesbenzoate estercarboxylic acid derivativebenzophenoneketonearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterhydrocarbon derivativeorganooxygen compoundaryl ketone |
|---|