| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:27 UTC |
|---|
| Update Date | 2025-03-21 18:02:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00037262 |
|---|
| Frequency | 94.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H20O2 |
|---|
| Molecular Mass | 268.1463 |
|---|
| SMILES | CC(C(=O)O)c1cccc(C(C)(C)c2ccccc2)c1 |
|---|
| InChI Key | FHIQPRFHGSZMEI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenylpropanesphenylpropanoic acids |
|---|
| Substituents | diphenylmethanecarbonyl groupcarboxylic acidcarboxylic acid derivativephenylpropanearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compound2-phenylpropanoic-acidhydrocarbon derivativeorganooxygen compound |
|---|
