| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:29 UTC |
|---|
| Update Date | 2025-03-21 18:02:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00037323 |
|---|
| Frequency | 94.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H29NO2 |
|---|
| Molecular Mass | 291.2198 |
|---|
| SMILES | COc1ccc(C(CN(C)C)C2(O)CCCCCC2)cc1 |
|---|
| InChI Key | CHTCQPFHXXAFSG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | prenol lipids |
|---|
| Subclass | monoterpenoids |
|---|
| Direct Parent | aromatic monoterpenoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,3-aminoalcoholsalkyl aryl ethersanisolescyclic alcohols and derivativeshydrocarbon derivativesmethoxybenzenesmonocyclic monoterpenoidsorganopnictogen compoundsphenoxy compoundstertiary alcoholstrialkylamines |
|---|
| Substituents | phenol ethermonocyclic benzene moietymonocyclic monoterpenoidetheralkyl aryl etherorganonitrogen compoundorganopnictogen compoundtertiary aminealcohol1,3-aminoalcoholtertiary aliphatic aminecyclic alcoholmethoxybenzenearomatic homomonocyclic compoundtertiary alcoholorganic oxygen compoundanisolehydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundamineorganooxygen compoundaromatic monoterpenoid |
|---|
