| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:30 UTC |
|---|
| Update Date | 2025-03-21 18:02:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00037366 |
|---|
| Frequency | 94.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H13NO3S |
|---|
| Molecular Mass | 299.0616 |
|---|
| SMILES | O=S(=O)(O)c1ccc(Nc2ccccc2)c2ccccc12 |
|---|
| InChI Key | ZSSXNYMMAYIRJZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalene sulfonic acids and derivatives |
|---|
| Direct Parent | 1-naphthalene sulfonic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-naphthalene sulfonates1-sulfo,2-unsubstituted aromatic compoundsarylsulfonic acids and derivativesbenzene and substituted derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compoundsorganosulfonic acidssecondary aminessulfonyls |
|---|
| Substituents | organosulfonic acid or derivativesmonocyclic benzene moiety1-sulfo,2-unsubstituted aromatic compoundorganosulfonic acidaromatic homopolycyclic compoundorganosulfur compoundsecondary amine1-naphthalene sulfonic acid or derivatives1-naphthalene sulfonateorganic oxidesulfonylarylsulfonic acid or derivativesorganic oxygen compoundorganic sulfonic acid or derivativesnaphthalene sulfonateorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundamine |
|---|
