| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:30 UTC |
|---|
| Update Date | 2025-03-21 18:02:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00037391 |
|---|
| Frequency | 94.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H9N3O4S |
|---|
| Molecular Mass | 219.0314 |
|---|
| SMILES | NC(CSC1NC(=O)NC1=O)C(=O)O |
|---|
| InChI Key | RTIAOAANDPQDJH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | cysteine and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acidsdialkylthioethersdicarboximideshydantoinshydrocarbon derivativesimidazolidinonesmonoalkylaminesmonocarboxylic acids and derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssulfenyl compoundsthiohemiaminal derivatives |
|---|
| Substituents | imidazolidinecarbonyl groupcarboxylic acidorganosulfur compoundimidazolidinoneorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidhemithioaminalorganopnictogen compounddicarboximideorganoheterocyclic compoundcarbonic acid derivativesulfenyl compoundazacycledialkylthioethermonocarboxylic acid or derivativesorganic oxygen compoundhydantointhioethercysteine or derivativeshydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
