| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:31 UTC |
|---|
| Update Date | 2025-03-21 18:02:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00037434 |
|---|
| Frequency | 94.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H11O11PS |
|---|
| Molecular Mass | 309.976 |
|---|
| SMILES | O=P(O)(O)OC1OC(COS(=O)(=O)O)C(O)C1O |
|---|
| InChI Key | LUMIOCWSICGIOH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalkyl sulfateshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundssecondary alcoholssulfuric acid monoesterstetrahydrofurans |
|---|
| Substituents | alcoholsulfuric acid monoesterorganic sulfuric acid or derivativestetrahydrofuranmonosaccharideoxacyclesaccharideorganic oxideorganic oxygen compoundmonoalkyl phosphatealkyl sulfatealiphatic heteromonocyclic compoundsecondary alcoholsulfate-esterhydrocarbon derivativesulfuric acid esterorganoheterocyclic compoundorganooxygen compound1,2-diol |
|---|
