| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:31 UTC |
|---|
| Update Date | 2025-03-21 18:02:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00037443 |
|---|
| Frequency | 94.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H12O5 |
|---|
| Molecular Mass | 188.0685 |
|---|
| SMILES | COC(=O)C1=CC(O)C(O)C(O)C1 |
|---|
| InChI Key | LSNUUAUXWJZSFD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | shikimic acids and derivatves |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundsenoate estershydrocarbon derivativesmethyl estersmonocarboxylic acids and derivativesorganic oxidessecondary alcohols |
|---|
| Substituents | enoate estercarbonyl groupcarboxylic acid derivativeshikimic acid or derivativesalpha,beta-unsaturated carboxylic esterorganic oxidemonocarboxylic acid or derivativesmethyl estercarboxylic acid estersecondary alcoholaliphatic homomonocyclic compoundhydrocarbon derivative |
|---|
