| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:34 UTC |
|---|
| Update Date | 2025-03-21 18:02:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00037537 |
|---|
| Frequency | 93.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C28H31ClN2O2 |
|---|
| Molecular Mass | 462.2074 |
|---|
| SMILES | CN(C)C(=O)C(CCN1CCC(O)(c2ccc(Cl)cc2)C1)(c1ccccc1)c1ccccc1 |
|---|
| InChI Key | RGXUFFVGLUGGBA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsamino acids and derivativesaryl chloridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeschlorobenzeneshydrocarbon derivativesn-acyl aminesn-alkylpyrrolidinesorganic oxidesorganochloridesorganopnictogen compoundsphenylacetamidesphenylpyrrolidinespyrrolestertiary alcoholstertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | diphenylmethanecarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativesorganochloridecarboxylic acid derivativeorganohalogen compoundorganic oxidetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundpyrrolidinephenylacetamidetertiary amineorganoheterocyclic compoundaryl chloridechlorobenzenealcoholazacyclen-alkylpyrrolidine1,2-aminoalcoholtertiary aliphatic aminecarboxamide groupn-acyl-aminearyl halide3-phenylpyrrolidinetertiary alcoholorganic oxygen compoundpyrrolehydrocarbon derivativeorganic nitrogen compoundhalobenzeneamineorganooxygen compound |
|---|