| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:49:36 UTC |
|---|
| Update Date | 2025-03-21 18:02:21 UTC |
|---|
| HMDB ID | HMDB0254657 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00037611 |
|---|
| Name | Methyl paraoxon |
|---|
| Frequency | 93.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10NO6P |
|---|
| Molecular Mass | 247.0246 |
|---|
| SMILES | COP(=O)(OC)Oc1ccc([N+](=O)[O-])cc1 |
|---|
| InChI Key | BAFQDKPJKOLXFZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | aryl dialkyl phosphates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | dialkyl phosphateshydrocarbon derivativesnitroaromatic compoundsnitrobenzenesorganic oxidesorganic oxoanionic compoundsorganic oxoazanium compoundsorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsphenoxy compoundspropargyl-type 1,3-dipolar organic compounds |
|---|
| Substituents | monocyclic benzene moietyallyl-type 1,3-dipolar organic compoundorganic nitro compoundpropargyl-type 1,3-dipolar organic compoundorganic oxidearyl dialkyl phosphatec-nitro compoundorganonitrogen compoundorganopnictogen compoundorganic oxoazaniumnitrobenzenenitroaromatic compoundorganic 1,3-dipolar compoundaromatic homomonocyclic compounddialkyl phosphateorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundorganooxygen compoundorganic hyponitrite |
|---|
