| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:37 UTC |
|---|
| Update Date | 2025-03-21 18:02:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00037664 |
|---|
| Frequency | 93.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H27NO3 |
|---|
| Molecular Mass | 353.1991 |
|---|
| SMILES | O=C(O)CCCN1CCC(C(O)(c2ccccc2)c2ccccc2)CC1 |
|---|
| InChI Key | ILFYVKBLOSUAJW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acidsamino fatty acidsaromatic alcoholsazacyclic compoundscarbonyl compoundscarboxylic acidsfatty acylshydrocarbon derivativeshydroxy fatty acidsmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundspiperidinestertiary alcoholstrialkylamines |
|---|
| Substituents | aromatic alcoholfatty acyldiphenylmethanecarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundamino acid or derivativesamino acidcarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundhydroxy fatty acidpiperidinetertiary amineorganoheterocyclic compoundalcoholazacycletertiary aliphatic amineamino fatty acidtertiary alcoholmonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|