| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:38 UTC |
|---|
| Update Date | 2025-03-21 18:02:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00037704 |
|---|
| Frequency | 93.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H12O5 |
|---|
| Molecular Mass | 236.0685 |
|---|
| SMILES | O=C1OCC2C1COC2c1ccc(O)c(O)c1 |
|---|
| InChI Key | FFHVPTKIBJCUDY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lignans, neolignans and related compounds |
|---|
| Class | lignan lactones |
|---|
| Subclass | lignan lactones |
|---|
| Direct Parent | lignan lactones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativescarbonyl compoundscarboxylic acid estersdialkyl ethersfuran lignansfurofuran lignansfurofuransgamma butyrolactoneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundstetrahydrofurans |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupetherfurofuran lignan skeleton1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativedialkyl etherlignan lactonelactoneorganic oxidearomatic heteropolycyclic compoundfurofuranorganoheterocyclic compoundtetrahydrofuran1-hydroxy-4-unsubstituted benzenoidgamma butyrolactoneoxacyclefuran lignan skeletonmonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterfuranoid lignanphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|