| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:41 UTC |
|---|
| Update Date | 2025-03-21 18:02:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00037814 |
|---|
| Frequency | 92.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H20O7 |
|---|
| Molecular Mass | 300.1209 |
|---|
| SMILES | O=C(CCC(O)Cc1ccc(O)c(O)c1)OCC(O)CO |
|---|
| InChI Key | LQOSKUIZUFGUBS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | glycerolipids |
|---|
| Subclass | monoradylglycerols |
|---|
| Direct Parent | 1-monoacylglycerols |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativescarbonyl compoundscarboxylic acid estersfatty acid estersglycerolipidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholfatty acylmonocyclic benzene moietycarbonyl group1-hydroxy-2-unsubstituted benzenoid1-acyl-sn-glycerol1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativearomatic homomonocyclic compoundfatty acid esterorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid estersecondary alcoholphenolhydrocarbon derivativebenzenoidprimary alcoholorganooxygen compound |
|---|
