| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:47 UTC |
|---|
| Update Date | 2025-03-21 18:02:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00038076 |
|---|
| Frequency | 92.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H14O5 |
|---|
| Molecular Mass | 226.0841 |
|---|
| SMILES | COc1ccc(C(CO)C(=O)O)cc1OC |
|---|
| InChI Key | LYBSDNUNQAZRMF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | methoxybenzenes |
|---|
| Direct Parent | dimethoxybenzenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenoxy compoundsprimary alcohols |
|---|
| Substituents | alcoholphenol ethercarbonyl groupethercarboxylic acidhydroxy acidalkyl aryl ethercarboxylic acid derivativearomatic homomonocyclic compounddimethoxybenzenebeta-hydroxy acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundanisoleo-dimethoxybenzenehydrocarbon derivativephenoxy compoundprimary alcoholorganooxygen compound |
|---|
