| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:49:48 UTC |
|---|
| Update Date | 2025-03-21 18:02:27 UTC |
|---|
| HMDB ID | HMDB0001564 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00038105 |
|---|
| Name | CDP-ethanolamine |
|---|
| Frequency | 92.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H20N4O11P2 |
|---|
| Molecular Mass | 446.0604 |
|---|
| SMILES | NCCOP(=O)(O)OP(=O)(O)OCC1OC(n2ccc(N)nc2=O)C(O)C1O |
|---|
| InChI Key | WVIMUEUQJFPNDK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | pyrimidine nucleotides |
|---|
| Subclass | pyrimidine ribonucleotides |
|---|
| Direct Parent | cdp-ethanolamines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsmonoalkyl phosphatesmonoalkylaminesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganic pyrophosphatesorganopnictogen compoundsoxacyclic compoundspentose phosphatesphosphoethanolaminespyrimidonessecondary alcoholstetrahydrofurans |
|---|
| Substituents | aromatic heteromonocyclic compoundpentose phosphatemonosaccharidepentose-5-phosphatepyrimidonepyrimidinephosphoethanolaminesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundcdp-ethanolamineimidolactamorganoheterocyclic compound1,2-diolalcoholcarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundorganic pyrophosphateoxacycleorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary aliphatic amineprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
