| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:48 UTC |
|---|
| Update Date | 2025-03-21 18:02:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00038115 |
|---|
| Frequency | 91.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H18N2O4 |
|---|
| Molecular Mass | 230.1267 |
|---|
| SMILES | CC(C)CC(=O)NC(=O)CCC(N)C(=O)O |
|---|
| InChI Key | PDEQJBIWNWFFGR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamine and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidsbranched fatty acidscarbonyl compoundscarboxylic acidsdicarboximideshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesn-acyl aminesn-unsubstituted carboxylic acid imidesorganic oxidesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidglutamine or derivativesfatty acidbranched fatty acidn-acyl-aminecarboxylic acid imidecarboxylic acid imide, n-unsubstitutedorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativeprimary aliphatic aminedicarboximideorganic nitrogen compoundorganooxygen compound |
|---|
