| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:52 UTC |
|---|
| Update Date | 2025-03-21 18:02:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00038261 |
|---|
| Frequency | 189.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H9N5O3 |
|---|
| Molecular Mass | 235.0705 |
|---|
| SMILES | CC(C(=O)O)c1c[nH]c2nc(N)nc(=O)c-2n1 |
|---|
| InChI Key | MWIZMEQVNFKYMQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acidsazacyclic compoundscarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsprimary aminespyrazinespyrimidones |
|---|
| Substituents | carbonyl groupcarboxylic acidamino acid or derivativesamino acidpyrimidonecarboxylic acid derivativepyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpterinazacycleheteroaromatic compoundmonocarboxylic acid or derivativesorganic oxygen compoundpyrazinehydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
