| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:49:53 UTC |
|---|
| Update Date | 2025-03-21 18:02:29 UTC |
|---|
| HMDB ID | HMDB0255118 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00038298 |
|---|
| Name | N-desmethyl loperamide |
|---|
| Frequency | 91.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C28H31ClN2O2 |
|---|
| Molecular Mass | 462.2074 |
|---|
| SMILES | CNC(=O)C(CCN1CCC(O)(c2ccc(Cl)cc2)CC1)(c1ccccc1)c1ccccc1 |
|---|
| InChI Key | ZMOPTLXEYOVARP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaryl chloridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeschlorobenzeneshydrocarbon derivativesn-acyl aminesorganic oxidesorganochloridesorganopnictogen compoundsphenylacetamidesphenylpiperidinessecondary carboxylic acid amidestertiary alcoholstrialkylamines |
|---|
| Substituents | fatty acyldiphenylmethanecarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativesorganochloridefatty amidecarboxylic acid derivativeorganohalogen compoundorganic oxideorganonitrogen compoundorganopnictogen compoundpiperidinephenylacetamidetertiary amineorganoheterocyclic compoundaryl chloridechlorobenzenealcoholazacycletertiary aliphatic aminecarboxamide groupn-acyl-aminearyl halidesecondary carboxylic acid amidetertiary alcoholorganic oxygen compoundphenylpiperidinehydrocarbon derivativeorganic nitrogen compoundhalobenzeneamineorganooxygen compound |
|---|
