Record Information |
---|
HMDB Status | detected |
---|
Creation Date | 2024-02-20 23:49:53 UTC |
---|
Update Date | 2025-03-21 18:02:29 UTC |
---|
HMDB ID | HMDB0255118 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00038298 |
---|
Name | N-desmethyl loperamide |
---|
Frequency | 91.5 |
---|
Structure | |
---|
Chemical Formula | C28H31ClN2O2 |
---|
Molecular Mass | 462.2074 |
---|
SMILES | CNC(=O)C(CCN1CCC(O)(c2ccc(Cl)cc2)CC1)(c1ccccc1)c1ccccc1 |
---|
InChI Key | ZMOPTLXEYOVARP-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | diphenylmethanes |
---|
Direct Parent | diphenylmethanes |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | amino acids and derivativesaryl chloridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeschlorobenzeneshydrocarbon derivativesn-acyl aminesorganic oxidesorganochloridesorganopnictogen compoundsphenylacetamidesphenylpiperidinessecondary carboxylic acid amidestertiary alcoholstrialkylamines |
---|
Substituents | fatty acyldiphenylmethanecarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativesorganochloridefatty amidecarboxylic acid derivativeorganohalogen compoundorganic oxideorganonitrogen compoundorganopnictogen compoundpiperidinephenylacetamidetertiary amineorganoheterocyclic compoundaryl chloridechlorobenzenealcoholazacycletertiary aliphatic aminecarboxamide groupn-acyl-aminearyl halidesecondary carboxylic acid amidetertiary alcoholorganic oxygen compoundphenylpiperidinehydrocarbon derivativeorganic nitrogen compoundhalobenzeneamineorganooxygen compound |
---|