| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:49:58 UTC |
|---|
| Update Date | 2025-03-21 18:02:31 UTC |
|---|
| HMDB ID | HMDB0028789 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00038491 |
|---|
| Name | Cysteinyl-Gamma-glutamate |
|---|
| Frequency | 90.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H15N3O4S |
|---|
| Molecular Mass | 249.0783 |
|---|
| SMILES | NC(CCC(=O)NC(=O)C(N)CS)C(=O)O |
|---|
| InChI Key | XPAFFAFOIOJDEH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamine and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkylthiolsalpha amino acid amidesalpha amino acidscarbonyl compoundscarboxylic acidscysteine and derivativesdicarboximidesfatty acids and conjugateshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesn-acyl aminesn-unsubstituted carboxylic acid imidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsorganosulfur compounds |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidglutamine or derivativesfatty acidorganosulfur compoundcarboxylic acid imide, n-unsubstitutedorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compounddicarboximidealpha-amino acid amiden-acyl-aminecarboxylic acid imidemonocarboxylic acid or derivativesorganic oxygen compoundcysteine or derivativeshydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundalkylthiolorganooxygen compound |
|---|
