| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:58 UTC |
|---|
| Update Date | 2025-03-21 18:02:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00038496 |
|---|
| Frequency | 90.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H12O3 |
|---|
| Molecular Mass | 228.0786 |
|---|
| SMILES | Oc1ccc(C2Cc3ccc(O)cc3O2)cc1 |
|---|
| InChI Key | YIJJOLJIRLQKFJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | 2-arylbenzofuran flavonoids |
|---|
| Subclass | 2-arylbenzofuran flavonoids |
|---|
| Direct Parent | 2-arylbenzofuran flavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersbenzene and substituted derivativescoumaranshydrocarbon derivativesoxacyclic compounds |
|---|
| Substituents | monocyclic benzene moietyether2-arylbenzofuran flavonoid1-hydroxy-2-unsubstituted benzenoidalkyl aryl etheroxacycleorganic oxygen compoundaromatic heteropolycyclic compoundphenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundcoumaranorganooxygen compound |
|---|
