| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:50:02 UTC |
|---|
| Update Date | 2025-03-21 18:02:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00038655 |
|---|
| Frequency | 90.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H10O8S |
|---|
| Molecular Mass | 278.0096 |
|---|
| SMILES | COc1cc(C(=O)OS(=O)(=O)O)c(C)c(O)c1O |
|---|
| InChI Key | JOZGNQADZTYESV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | m-methoxybenzoic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersanisolesbenzoic acids and derivativesbenzoyl derivativeshydrocarbon derivativesmeta cresolsmethoxybenzenesmethoxyphenolsmonocarboxylic acids and derivativesorganic oxidesortho cresolsphenoxy compoundssulfuric acid monoesterstoluenes |
|---|
| Substituents | phenol ethersulfuric acid monoesterethermethoxyphenolbenzoylalkyl aryl ethercarboxylic acid derivativeorganic oxideo-cresolm-methoxybenzoic acid or derivativesorganic sulfuric acid or derivativesm-cresol1-hydroxy-4-unsubstituted benzenoidmethoxybenzenearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundanisolephenolhydrocarbon derivativephenoxy compoundsulfuric acid estertolueneorganooxygen compound |
|---|