| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:50:04 UTC |
|---|
| Update Date | 2025-03-21 18:02:32 UTC |
|---|
| HMDB ID | HMDB0137958 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00038701 |
|---|
| Name | 2-benzoylbenzene-1,3,5-triol |
|---|
| Frequency | 90.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H10O4 |
|---|
| Molecular Mass | 230.0579 |
|---|
| SMILES | O=C(c1ccccc1)c1c(O)cc(O)cc1O |
|---|
| InChI Key | CPEXFJVZFNYXGU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsaryl ketonesaryl-phenylketonesbenzoyl derivativesdiphenylmethaneshydrocarbon derivativesorganic oxidesorganooxygen compoundsphloroglucinols and derivativesvinylogous acids |
|---|
| Substituents | diphenylmethanebenzenetriolaryl-phenylketonebenzoyl1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidbenzophenoneketonephloroglucinol derivativearomatic homomonocyclic compoundvinylogous acidorganic oxideorganic oxygen compoundphenolhydrocarbon derivativeorganooxygen compoundaryl ketone |
|---|
