| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:50:04 UTC |
|---|
| Update Date | 2025-03-21 18:02:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00038724 |
|---|
| Frequency | 90.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H16NO8P |
|---|
| Molecular Mass | 297.0614 |
|---|
| SMILES | O=C1CCCN1C1OC(COP(=O)(O)O)C(O)C1O |
|---|
| InChI Key | FWRCTJJDVBVMMT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativeslactamsmonoalkyl phosphatesmonosaccharidesn-alkylpyrrolidinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspyrrolidine-2-onessecondary alcoholstertiary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | 2-pyrrolidonecarbonyl grouplactampentose phosphatepentose-5-phosphatecarboxylic acid derivativeorganic oxidetertiary carboxylic acid amidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundpyrrolidinepyrrolidoneorganoheterocyclic compound1,2-diolalcoholazacyclen-alkylpyrrolidinetetrahydrofurancarboxamide groupoxacyclephosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|
