| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:50:06 UTC |
|---|
| Update Date | 2025-03-21 18:02:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00038769 |
|---|
| Frequency | 90.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C27H34O16 |
|---|
| Molecular Mass | 614.1847 |
|---|
| SMILES | OCC1OC(OCC2OC(Oc3cc(O)c4c(c3)OC(c3ccc(O)c(O)c3)C(O)C4)C(O)C(O)C2O)C(O)C(O)C1O |
|---|
| InChI Key | DLMOKKBPDFSJNU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavonoid glycosides |
|---|
| Direct Parent | flavonoid-7-o-glycosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids3-hydroxyflavonoids4'-hydroxyflavonoids5-hydroxyflavonoidsacetalsalkyl aryl ethersbenzene and substituted derivativescatechinshydrocarbon derivativesmonosaccharidesoxacyclic compoundsoxanesphenol ethersprimary alcoholssecondary alcohols |
|---|
| Substituents | phenol ethermonocyclic benzene moiety3-hydroxyflavonoidether1-benzopyranflavan1-hydroxy-2-unsubstituted benzenoidmonosaccharidealkyl aryl ethersaccharideacetalaromatic heteropolycyclic compoundchromanecatechinoxaneflavan-3-olprimary alcoholorganoheterocyclic compoundflavonoid-7-o-glycosidealcoholbenzopyran5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacycleorganic oxygen compoundsecondary alcohol4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|