| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:50:08 UTC |
|---|
| Update Date | 2025-03-21 18:02:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00038850 |
|---|
| Frequency | 89.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H14ClNO5 |
|---|
| Molecular Mass | 239.056 |
|---|
| SMILES | CC(=O)NC1C(O)OC(CO)C(Cl)C1O |
|---|
| InChI Key | XFMKCUGHLZDKCE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl chloridescarbonyl compoundscarboxylic acids and derivativeschlorohydrinshemiacetalshydrocarbon derivativesorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupchlorohydrinalkyl chlorideorganochloridemonosaccharidecarboxylic acid derivativeorganohalogen compoundorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetalalkyl halideoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholhalohydrincarboxamide groupoxacyclesecondary carboxylic acid amidesecondary alcoholhydrocarbon derivativeorganic nitrogen compound |
|---|
