| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:50:09 UTC |
|---|
| Update Date | 2025-03-21 18:02:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00038897 |
|---|
| Frequency | 89.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H8O7 |
|---|
| Molecular Mass | 192.027 |
|---|
| SMILES | O=C1C(O)OC(C(=O)O)C(O)C1O |
|---|
| InChI Key | PSFQGMCGWCTJRC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyran carboxylic acids and derivatives |
|---|
| Direct Parent | pyran carboxylic acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsbeta hydroxy acids and derivativescarboxylic acidscyclic ketoneshemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidmonosaccharidecyclic ketonecarboxylic acid derivativeketonebeta-hydroxy acidsaccharideorganic oxidealiphatic heteromonocyclic compoundhemiacetaloxane1,2-diolalcoholpyran carboxylic acid or derivativeshydroxy acidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|