| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:50:11 UTC |
|---|
| Update Date | 2025-03-21 18:02:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00038981 |
|---|
| Frequency | 89.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H22O12 |
|---|
| Molecular Mass | 370.1111 |
|---|
| SMILES | O=C(O)C1C(O)C(O)C(O)C(OC2OC(CO)C(O)C(O)C2O)C1O |
|---|
| InChI Key | WEOZJBNGIDTBAZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidscyclitols and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesprimary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidcyclohexanolmonosaccharidecyclitol or derivativeshydroxy acidcyclic alcoholcarboxylic acid derivativeoxacyclebeta-hydroxy acidsaccharideorganic oxidemonocarboxylic acid or derivativesacetalaliphatic heteromonocyclic compoundhydrocarbon derivativeoxaneprimary alcoholorganoheterocyclic compound |
|---|