Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:50:20 UTC |
---|
Update Date | 2025-03-21 18:02:38 UTC |
---|
HMDB ID | HMDB0002109 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00039313 |
---|
Name | Hydroxysepiapterin |
---|
Frequency | 88.6 |
---|
Structure | |
---|
Chemical Formula | C9H11N5O4 |
---|
Molecular Mass | 253.0811 |
---|
SMILES | Nc1nc(=O)c2c([nH]1)NCC(C(=O)C(O)CO)=N2 |
---|
InChI Key | QHNIUIKIRXYAAW-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | pteridines and derivatives |
---|
Subclass | pterins and derivatives |
---|
Direct Parent | pterins and derivatives |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1,2-diolsacyloinsazacyclic compoundsbeta-hydroxy ketonesheteroaromatic compoundshydrocarbon derivativesketiminesmonosaccharidesorganic oxidesorganopnictogen compoundsprimary alcoholsprimary aminespropargyl-type 1,3-dipolar organic compoundspyrimidonessecondary alcoholssecondary alkylarylaminesvinylogous amides |
---|
Substituents | beta-hydroxy ketoneketiminecarbonyl groupiminemonosaccharidepyrimidonepyrimidinepropargyl-type 1,3-dipolar organic compoundketonesaccharideorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundprimary alcohol1,2-diolalcoholvinylogous amidepterinazacycleheteroaromatic compoundorganic 1,3-dipolar compoundsecondary aminesecondary aliphatic/aromatic amineorganic oxygen compoundacyloinsecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
---|