| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:50:20 UTC |
|---|
| Update Date | 2025-03-21 18:02:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00039320 |
|---|
| Frequency | 88.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H16N4O4 |
|---|
| Molecular Mass | 244.1172 |
|---|
| SMILES | NCc1ncn(C2OC(CO)C(O)C2O)c1N |
|---|
| InChI Key | GGVGHLPDMUJFTK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | imidazole ribonucleosides and ribonucleotides |
|---|
| Subclass | imidazole ribonucleosides and ribonucleotides |
|---|
| Direct Parent | imidazole ribonucleosides and ribonucleotides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesmonoalkylaminesmonosaccharidesn-substituted imidazolesorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholstetrahydrofurans |
|---|
| Substituents | imidazole ribonucleosidearomatic heteromonocyclic compoundmonosaccharidesaccharideimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholorganoheterocyclic compoundazolen-substituted imidazolealcoholazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary aliphatic amineprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
