| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:50:20 UTC |
|---|
| Update Date | 2025-03-21 18:02:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00039336 |
|---|
| Frequency | 88.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H29ClN8O4 |
|---|
| Molecular Mass | 468.2 |
|---|
| SMILES | N=C(NCCCCCCNC(=N)NC(CC(=O)O)C(=O)O)NC(=N)Nc1ccc(Cl)cc1 |
|---|
| InChI Key | GNUGIMXQRVAXRO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | aspartic acid and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-arylbiguanidesalpha amino acidsaryl chloridescarbonyl compoundscarboximidamidescarboxylic acidschlorobenzenesdicarboxylic acids and derivativeshydrocarbon derivativesiminesorganic oxidesorganochloridesorganopnictogen compounds |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidguanidineimineorganochlorideorganohalogen compoundorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compound1-arylbiguanidearyl chloridechlorobenzenecarboximidamidearyl halidearomatic homomonocyclic compoundarylbiguanideorganic oxygen compoundaspartic acid or derivativesdicarboxylic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundbiguanidehalobenzeneorganooxygen compound |
|---|