Record Information |
---|
HMDB Status | detected |
---|
Creation Date | 2024-02-20 23:50:26 UTC |
---|
Update Date | 2025-03-21 18:02:40 UTC |
---|
HMDB ID | HMDB0258334 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00039541 |
---|
Name | Skimmin |
---|
Frequency | 87.9 |
---|
Structure | |
---|
Chemical Formula | C15H16O8 |
---|
Molecular Mass | 324.0845 |
---|
SMILES | O=c1ccc2ccc(OC3OC(CO)C(O)C(O)C3O)cc2o1 |
---|
InChI Key | VPAOSFFTKWUGAD-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | coumarins and derivatives |
---|
Subclass | coumarin glycosides |
---|
Direct Parent | coumarin glycosides |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-benzopyransacetalsheteroaromatic compoundshydrocarbon derivativeslactonesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol ethersprimary alcoholspyranones and derivativessecondary alcohols |
---|
Substituents | coumarin-7-o-glycosidephenol ethercoumarin o-glycoside1-benzopyranmonosaccharidelactonesaccharideorganic oxideacetalaromatic heteropolycyclic compoundpyranoneoxaneprimary alcoholorganoheterocyclic compoundalcoholbenzopyranheteroaromatic compoundoxacycleorganic oxygen compoundpyransecondary alcoholhydrocarbon derivativebenzenoidorganooxygen compound |
---|