| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:50:30 UTC |
|---|
| Update Date | 2025-03-21 18:02:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00039693 |
|---|
| Frequency | 96.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H15N2O9P |
|---|
| Molecular Mass | 338.0515 |
|---|
| SMILES | COC1C(OP(=O)(O)O)C(CO)OC1n1ccc(=O)[nH]c1=O |
|---|
| InChI Key | NPRNBAPBGVERRF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | ribonucleoside 3'-phosphates |
|---|
| Subclass | ribonucleoside 3'-phosphates |
|---|
| Direct Parent | ribonucleoside 3'-phosphates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdialkyl ethersheteroaromatic compoundshydrocarbon derivativeslactamsmonoalkyl phosphatesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholspyrimidonestetrahydrofuransvinylogous amides |
|---|
| Substituents | etherlactamaromatic heteromonocyclic compoundpyrimidonedialkyl etherpyrimidineorganic oxideorganonitrogen compoundorganopnictogen compoundprimary alcoholorganoheterocyclic compoundribonucleoside 3'-phosphatealcoholvinylogous amidecarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundphosphoric acid estermonoalkyl phosphatehydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|