| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:50:30 UTC |
|---|
| Update Date | 2025-03-21 18:02:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00039698 |
|---|
| Frequency | 87.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C31H55NO23 |
|---|
| Molecular Mass | 809.3165 |
|---|
| SMILES | CC(=O)NC1C(OC2C(O)C(CO)OC(OC(C(O)CO)C(O)CO)C2O)OC(CO)C(OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O |
|---|
| InChI Key | BJZLARHGESPDQD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | n-acyl-alpha-hexosamines |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | alcoholcarbonyl groupmonosaccharidecarboxamide groupcarboxylic acid derivativen-acyl-alpha-hexosamineoxacyclesecondary carboxylic acid amideorganic oxideacetalaliphatic heteromonocyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamide |
|---|