| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:50:31 UTC |
|---|
| Update Date | 2025-03-21 18:02:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00039758 |
|---|
| Frequency | 87.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H12O11P2 |
|---|
| Molecular Mass | 309.9855 |
|---|
| SMILES | O=P(O)(O)OCC1OC(O)(P(=O)(O)O)C(O)C1O |
|---|
| InChI Key | MNXRITLTWYUEBK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolshydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesorganic oxidesorganic phosphonic acids and derivativesorganophosphorus compoundsorganopnictogen compoundsoxacyclic compoundssecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholtetrahydrofuranpentose phosphatepentose-5-phosphateoxacycleorganic oxidephosphoric acid estermonoalkyl phosphatealiphatic heteromonocyclic compoundsecondary alcoholorganopnictogen compoundorganophosphorus compoundhydrocarbon derivativeorganic phosphoric acid derivativeorganophosphonic acid derivativealkyl phosphateorganoheterocyclic compound1,2-diol |
|---|
