DeepMet

Record Information
HMDB Status	Not Available
Creation Date	2024-02-20 23:50:32 UTC
Update Date	2025-03-21 18:02:43 UTC
HMDB ID	Not Available
Metabolite Identification
DeepMet ID	DMID00039790
Frequency	87.2
Structure
Chemical Formula	C₁₅H₂₀N₂O₄
Molecular Mass	292.1423
SMILES	O=C(O)C(Cc1ccc(O)cc1)NC(=O)C1CCCCN1
InChI Key	CKWOWGVLSXDQDM-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	organic acids and derivatives
Class	carboxylic acids and derivatives
Subclass	amino acids, peptides, and analogues
Direct Parent	dipeptides
Geometric Descriptor	aromatic heteromonocyclic compounds
Alternative Parents	1-hydroxy-2-unsubstituted benzenoids alpha amino acid amides alpha amino acids amino acids amphetamines and derivatives azacyclic compounds benzene and substituted derivatives carbonyl compounds carboxylic acids dialkylamines hydrocarbon derivatives monocarboxylic acids and derivatives n-acyl-alpha amino acids organic oxides organopnictogen compounds phenylalanine and derivatives phenylpropanoic acids piperidinecarboxamides piperidines secondary carboxylic acid amides tyrosine and derivatives
Substituents	monocyclic benzene moiety carbonyl group carboxylic acid aromatic heteromonocyclic compound 3-phenylpropanoic-acid amino acid or derivatives amino acid 1-hydroxy-2-unsubstituted benzenoid alpha-amino acid or derivatives organic oxide organonitrogen compound alpha-amino acid organopnictogen compound piperidine organoheterocyclic compound amphetamine or derivatives n-acyl-alpha amino acid or derivatives secondary aliphatic amine tyrosine or derivatives alpha-amino acid amide azacycle n-acyl-alpha-amino acid piperidinecarboxamide secondary amine carboxamide group alpha-dipeptide secondary carboxylic acid amide monocarboxylic acid or derivatives phenylalanine or derivatives organic oxygen compound phenol hydrocarbon derivative benzenoid organic nitrogen compound 2-piperidinecarboxamide organooxygen compound amine

Showing information for DMID00039790