| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:50:34 UTC |
|---|
| Update Date | 2025-03-21 18:02:43 UTC |
|---|
| HMDB ID | HMDB0130374 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00039873 |
|---|
| Name | 3-(3,4-dihydroxyphenyl)-7-methoxy-4H-chromen-4-one |
|---|
| Frequency | 86.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12O5 |
|---|
| Molecular Mass | 284.0685 |
|---|
| SMILES | COc1ccc2c(=O)c(-c3ccc(O)c(O)c3)coc2c1 |
|---|
| InChI Key | AFCJRSVBONSNTR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | o-methylated isoflavonoids |
|---|
| Direct Parent | 7-o-methylisoflavones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersanisolesbenzene and substituted derivativeschromonesheteroaromatic compoundshydrocarbon derivativesisoflavonesisoflavonoidsorganic oxidesoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | phenol ethermonocyclic benzene moietyether1-benzopyran1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compound7-o-methylisoflavoneisoflavonebenzopyranheteroaromatic compound1-hydroxy-4-unsubstituted benzenoidoxacycleorganic oxygen compoundpyrananisolephenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
