| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:50:35 UTC |
|---|
| Update Date | 2025-03-21 18:02:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00039909 |
|---|
| Frequency | 86.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H15NO3S |
|---|
| Molecular Mass | 229.0773 |
|---|
| SMILES | Cc1ccc(C(C)C)c(OS(N)(=O)=O)c1 |
|---|
| InChI Key | NGOBKFKRQCPQDI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | prenol lipids |
|---|
| Subclass | monoterpenoids |
|---|
| Direct Parent | aromatic monoterpenoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | cumeneshydrocarbon derivativesmonocyclic monoterpenoidsorganic nitrogen compoundsorganic oxidesorganic sulfuric acids and derivativesorganooxygen compoundsphenoxy compoundsphenylpropanestoluenes |
|---|
| Substituents | monocyclic benzene moietymonocyclic monoterpenoidorganic sulfuric acid or derivativesp-cymenephenylpropanearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundcumenehydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundtolueneorganooxygen compoundaromatic monoterpenoid |
|---|