Record Information |
---|
HMDB Status | quantified |
---|
Creation Date | 2024-02-20 23:50:35 UTC |
---|
Update Date | 2025-03-21 18:02:44 UTC |
---|
HMDB ID | HMDB0013326 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00039918 |
---|
Name | trans-2-Dodecenoylcarnitine |
---|
Frequency | 86.8 |
---|
Structure | |
---|
Chemical Formula | C19H36NO4+ |
---|
Molecular Mass | 342.2639 |
---|
SMILES | CCCCCCCCCC=CC(=O)OC(CCC(=O)O)[N+](C)(C)C |
---|
InChI Key | JEOZLTJHDSKQIT-UHFFFAOYSA-O |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | lipids and lipid-like molecules |
---|
Class | fatty acyls |
---|
Subclass | fatty acid esters |
---|
Direct Parent | fatty acid esters |
---|
Geometric Descriptor | aliphatic acyclic compounds |
---|
Alternative Parents | carbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesenoate estershydrocarbon derivativesorganic cationsorganic oxidesorganic saltsorganonitrogen compoundsorganopnictogen compoundsshort-chain hydroxy acids and derivativestetraalkylammonium salts |
---|
Substituents | enoate esteraliphatic acyclic compoundcarbonyl groupcarboxylic acidshort-chain hydroxy acidtetraalkylammonium saltcarboxylic acid derivativealpha,beta-unsaturated carboxylic esterfatty acid esterorganic oxideorganic oxygen compoundcarboxylic acid esterorganonitrogen compounddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationorganic saltorganooxygen compound |
---|