| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:50:38 UTC |
|---|
| Update Date | 2025-03-21 18:02:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00040035 |
|---|
| Frequency | 86.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H14O3 |
|---|
| Molecular Mass | 218.0943 |
|---|
| SMILES | C=CC(=O)Cc1ccc(C(C)C(=O)O)cc1 |
|---|
| InChI Key | GZWZJMMPLGKSNL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | phenylpropanoic acids |
|---|
| Subclass | phenylpropanoic acids |
|---|
| Direct Parent | phenylpropanoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acryloyl compoundsaromatic monoterpenoidsbenzene and substituted derivativescarboxylic acidsenoneshydrocarbon derivativesketonesmonocarboxylic acids and derivativesmonocyclic monoterpenoidsorganic oxides |
|---|
| Substituents | monoterpenoidmonocyclic benzene moietycarbonyl groupmonocyclic monoterpenoidcarboxylic acidp-cymenealpha,beta-unsaturated ketonecarboxylic acid derivativeketonearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compound2-phenylpropanoic-acidhydrocarbon derivativebenzenoidacryloyl-grouporganooxygen compoundaromatic monoterpenoidenone |
|---|
