Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-20 23:50:40 UTC |
---|
Update Date | 2025-03-21 18:02:45 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00040117 |
---|
Frequency | 86.3 |
---|
Structure | |
---|
Chemical Formula | C11H13NO3 |
---|
Molecular Mass | 207.0895 |
---|
SMILES | CCOC(=O)c1ccc(NC(C)=O)cc1 |
---|
InChI Key | NHLOBHNRBWKNIO-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | benzoic acids and derivatives |
---|
Direct Parent | acylaminobenzoic acid and derivatives |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | acetamidesacetanilidesbenzoic acid estersbenzoyl derivativescarbonyl compoundscarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesn-acetylarylaminesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amides |
---|
Substituents | carbonyl groupn-acetylarylaminebenzoyln-arylamidebenzoate estercarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundacetamideacylaminobenzoic acid or derivativesacetanilidecarboxamide grouparomatic homomonocyclic compoundanilidesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
---|