Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:50:41 UTC |
---|
Update Date | 2025-03-21 18:02:45 UTC |
---|
HMDB ID | HMDB0001328 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00040127 |
---|
Name | dTDP-D-glucose |
---|
Frequency | 86.3 |
---|
Structure | |
---|
Chemical Formula | C16H26N2O16P2 |
---|
Molecular Mass | 564.0758 |
---|
SMILES | Cc1cn(C2CC(O)C(COP(=O)(O)OP(=O)(O)OC3OC(CO)C(O)C(O)C3O)O2)c(=O)[nH]c1=O |
---|
InChI Key | YSYKRGRSMLTJNL-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | pentose phosphates |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsmonoalkyl phosphatesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganic pyrophosphatesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspyrimidonessecondary alcoholstetrahydrofuransvinylogous amides |
---|
Substituents | lactamaromatic heteromonocyclic compoundpentose phosphatepyrimidonepyrimidineorganic oxideorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundalcoholvinylogous amidecarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundorganic pyrophosphateoxacyclephosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
---|