| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:50:42 UTC |
|---|
| Update Date | 2025-03-21 18:02:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00040176 |
|---|
| Frequency | 86.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H5NO5S |
|---|
| Molecular Mass | 190.9888 |
|---|
| SMILES | NS(=O)(=O)c1ccc(C(=O)O)o1 |
|---|
| InChI Key | TWICVBFROQJBSY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | furans |
|---|
| Subclass | furoic acid and derivatives |
|---|
| Direct Parent | furoic acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aminosulfonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic nitrogen compoundsorganic oxidesorganooxygen compoundsorganosulfonamidesoxacyclic compounds |
|---|
| Substituents | organosulfonic acid or derivativescarboxylic acidaromatic heteromonocyclic compoundaminosulfonyl compoundheteroaromatic compoundorganosulfur compoundcarboxylic acid derivativefuroic acidorganosulfonic acid amideoxacycleorganic oxidemonocarboxylic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
