| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:50:45 UTC |
|---|
| Update Date | 2025-03-21 18:02:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00040310 |
|---|
| Frequency | 85.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H12NO7P |
|---|
| Molecular Mass | 241.0351 |
|---|
| SMILES | NC(CCCC(=O)OP(=O)(O)O)C(=O)O |
|---|
| InChI Key | FTCOPJNDHCFTOL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | delta amino acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acyl monophosphatesalpha amino acidscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesmedium-chain fatty acidsmonoalkylaminesorganic oxidesorganic phosphoric acids and derivativesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidacyl monophosphatefatty acidalpha-amino acid or derivativesorganic oxideorganic oxygen compoundorganonitrogen compoundalpha-amino aciddicarboxylic acid or derivativesorganopnictogen compounddelta amino acid or derivativeshydrocarbon derivativemedium-chain fatty acidprimary aliphatic amineorganic nitrogen compoundorganic phosphoric acid derivativeorganooxygen compoundacyl phosphate |
|---|
