| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:50:45 UTC |
|---|
| Update Date | 2025-03-21 18:02:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00040324 |
|---|
| Frequency | 85.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C28H47N6O10+ |
|---|
| Molecular Mass | 627.3348 |
|---|
| SMILES | NC(CCCC[n+]1c(CCC(N)C(=O)O)cc(CCC(N)C(=O)O)c(CCC(N)C(=O)O)c1CCCC(N)C(=O)O)C(=O)O |
|---|
| InChI Key | XFCBQASEIZFFGY-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | pentacarboxylic acids and derivatives |
|---|
| Direct Parent | pentacarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesalpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmonoalkylaminesorganic cationsorganic oxidesorganonitrogen compoundsorganopnictogen compoundspolyhalopyridines |
|---|
| Substituents | carbonyl groupcarboxylic acidaromatic heteromonocyclic compoundazacyclepolyhalopyridineheteroaromatic compoundhydroxypyridinealpha-amino acid or derivativespentacarboxylic acid or derivativesorganic oxidepyridineorganic oxygen compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amine2-halopyridineorganic nitrogen compoundorganic cationorganoheterocyclic compoundorganooxygen compound |
|---|