| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:50:47 UTC |
|---|
| Update Date | 2025-03-21 18:02:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00040370 |
|---|
| Frequency | 85.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H13NO8 |
|---|
| Molecular Mass | 311.0641 |
|---|
| SMILES | O=C1Nc2ccccc2OC1OC1OC(C(=O)O)C(O)C1O |
|---|
| InChI Key | CAKPCQKQZGKIJE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzoxazines |
|---|
| Subclass | benzoxazinones |
|---|
| Direct Parent | benzoxazinones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsacetalsazacyclic compoundsbenzenoidsbenzomorpholinesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativeslactamsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundssecondary alcoholssecondary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | carbonyl grouplactamcarboxylic acidmonosaccharidecarboxylic acid derivativebenzomorpholinebeta-hydroxy acidsaccharideorganic oxideacetalaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compound1,2-diolalcoholazacycletetrahydrofuranhydroxy acidcarboxamide groupoxazinaneoxacyclesecondary carboxylic acid amidemorpholinemonocarboxylic acid or derivativesbenzoxazinoneorganic oxygen compoundsecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
