| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:50:48 UTC |
|---|
| Update Date | 2025-03-21 18:02:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00040435 |
|---|
| Frequency | 85.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14O5 |
|---|
| Molecular Mass | 274.0841 |
|---|
| SMILES | CC(C(=O)c1ccc(O)cc1)c1c(O)cc(O)cc1O |
|---|
| InChI Key | CBDSBLMWCDAPSJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | stilbenes |
|---|
| Subclass | stilbenes |
|---|
| Direct Parent | stilbenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl-phenylketonesaryl alkyl ketonesbenzoyl derivativeshydrocarbon derivativesorganic oxidesorganooxygen compoundsphenylpropanesphloroglucinols and derivatives |
|---|
| Substituents | monocyclic benzene moietyaryl alkyl ketonebenzenetriolbenzoyl1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidphenylketoneketonephenylpropanephloroglucinol derivativearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundphenolhydrocarbon derivativebenzenoidalkyl-phenylketoneorganooxygen compoundaryl ketonestilbene |
|---|